Difference between revisions of "FA160COAabcp"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2109 == * left end position: ** 27990 * transcription direction: ** NEGATIVE * right end position: ** 30232 * centisome position: ** 92.584...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C) |
− | * | + | * common name: |
− | ** | + | ** echinenone |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 550.866 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[R07562]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIPID_MAPS : LMPR01070060 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281236 5281236] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4444648.html 4444648] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4746 4746] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08592 C08592] | ||
+ | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}} | ||
+ | {{#set: common name=echinenone}} | ||
+ | {{#set: inchi key=InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N}} | ||
+ | {{#set: molecular weight=550.866 }} | ||
+ | {{#set: consumed by=R07562}} |
Revision as of 17:06, 21 March 2018
Contents
Metabolite CPD-7850
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
- common name:
- echinenone
- inchi key:
- InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N
- molecular weight:
- 550.866
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links