Difference between revisions of "3.6.3.50-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8935 == * left end position: ** 8277 * transcription direction: ** POSITIVE * right end position: ** 8713 * centisome position: ** 84.75323...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_8935 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] ==
−
* left end position:
+
* smiles:
−
** 8277
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
−
* right end position:
+
* inchi key:
−
** 8713
+
** InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
−
* centisome position:
+
* molecular weight:
−
** 84.75323    
+
** 412.698    
 
* Synonym(s):
 
* Synonym(s):
 +
** 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
 +
** 4α-methyl-5α-ergosta-8,24-dien-3β-ol
 +
** 4α-methylfecosterol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DAHPSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-4144]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6164]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=8277}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193524 193524]
−
{{#set: right end position=8713}}
+
* HMDB : HMDB06845
−
{{#set: centisome position=84.75323   }}
+
* CHEBI:
−
{{#set: reaction associated=DAHPSYN-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80094 80094]
−
{{#set: pathway associated=PWY-6164}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15776 C15776]
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
 +
{{#set: common name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}}
 +
{{#set: inchi key=InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N}}
 +
{{#set: molecular weight=412.698   }}
 +
{{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol|4α-methyl-5α-ergosta-8,24-dien-3β-ol|4α-methylfecosterol}}
 +
{{#set: produced by=RXN-4144}}

Revision as of 16:06, 21 March 2018

Metabolite CPD-4081

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • common name:
    • 4α-methyl-5α-ergosta-8,24-dien-3β-ol
  • inchi key:
    • InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
    • 4α-methyl-5α-ergosta-8,24-dien-3β-ol
    • 4α-methylfecosterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.6.3.50-RXN&oldid=38767"