Difference between revisions of "Very-Long-Chain-Trans-23-Dehydroacyl-CoA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5282 RXN-5282] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * common name: ** (S)-2...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5282 RXN-5282] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)C(C)(O)C(=O)[O-]
 +
* common name:
 +
** (S)-2-acetolactate
 +
* inchi key:
 +
** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
 +
* molecular weight:
 +
** 131.108   
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-2-hydroxy-2-methyl-3-oxobutanoate
 +
** α-acetolactate
 +
** (2S)-2-hydroxy-2-methyl-3-oxobutanoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-6081]]
−
** 1 [[PROTON]][c] '''+''' 1 [[MG-PROTOPORPHYRIN-MONOMETHYL-ESTER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[13-HYDROXY-MAGNESIUM-PROTOPORP]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[ACETOLACTSYN-RXN]]
−
** 1 H+[c] '''+''' 1 magnesium-protoporphyrin IX 13-monomethyl ester[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 H2O[c] '''+''' 1 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester[c] '''+''' 1 NADP+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[ACETOLACTREDUCTOISOM-RXN]]
−
== Genes associated with this reaction  ==
+
* [[RXN-14037]]
−
== Pathways  ==
+
−
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06265 R06265]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB06855
−
{{#set: in pathway=CHLOROPHYLL-SYN|PWY-7159}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=manual}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010]
−
{{#set: reconstruction source=manual-primary_network}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476]
 +
* BIGG : alac__S
 +
{{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}}
 +
{{#set: common name=(S)-2-acetolactate}}
 +
{{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}}
 +
{{#set: molecular weight=131.108    }}
 +
{{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}}
 +
{{#set: consumed by=RXN-6081}}
 +
{{#set: produced by=ACETOLACTSYN-RXN}}
 +
{{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN|RXN-14037}}

Revision as of 16:08, 21 March 2018

Metabolite 2-ACETO-LACTATE

  • smiles:
    • CC(=O)C(C)(O)C(=O)[O-]
  • common name:
    • (S)-2-acetolactate
  • inchi key:
    • InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
  • molecular weight:
    • 131.108
  • Synonym(s):
    • (S)-2-hydroxy-2-methyl-3-oxobutanoate
    • α-acetolactate
    • (2S)-2-hydroxy-2-methyl-3-oxobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)C(C)(O)C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Very-Long-Chain-Trans-23-Dehydroacyl-CoA&oldid=39065"