Difference between revisions of "DITP"

Revision as of 16:08, 21 March 2018

"2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_8573 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] ==
-* left end position:
+* smiles:
-** 407
+** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
-* transcription direction:
+* common name:
-** POSITIVE
+** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
-* right end position:
+* inchi key:
-** 2180
+** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
-* centisome position:
+* molecular weight:
-** 4.030501
+** 223.234
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[2.3.1.97-RXN]]
+* [[RXN-15733]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=407}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804]
-{{#set: right end position=2180}}
+{{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}}
-{{#set: centisome position=4.030501    }}
+{{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
-{{#set: reaction associated=2.3.1.97-RXN}}
+{{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}}
+{{#set: molecular weight=223.234    }}
+{{#set: consumed by=RXN-15733}}