Difference between revisions of "Tiso gene 14122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIA PGIA] == * direction: ** REVERSIBLE * common name: ** glucose-6-phosphate isomerase (g6p-A) *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIA PGIA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
 +
* inchi key:
 +
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
 
* common name:
 
* common name:
−
** glucose-6-phosphate isomerase (g6p-A)
+
** 5-enolpyruvoyl-shikimate 3-phosphate
 +
* molecular weight:
 +
** 320.149   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-enolpyruvyl-shikimate 5-phosphate
 +
** 3-enolpyruvyl-shikimate-5-P
 +
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
 +
** 5-enolpyruvyl-shikimate 3-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[CHORISMATE-SYNTHASE-RXN]]
−
** 1.0 [[ALPHA-GLC-6-P]][c] '''<=>''' 1.0 [[FRUCTOSE-6P]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 &alpha;-D-glucose 6-phosphate[c] '''<=>''' 1.0 &beta;-D-fructofuranose 6-phosphate[c]
+
* [[2.5.1.19-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19480]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=glucose-6-phosphate isomerase (g6p-A)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
−
{{#set: gene associated=Tiso_gene_19480}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
−
{{#set: reconstruction category=orthology}}
+
* BIGG : 3psme
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
 +
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
 +
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
 +
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
 +
{{#set: molecular weight=320.149    }}
 +
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
 +
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
 +
{{#set: consumed or produced by=2.5.1.19-RXN}}

Revision as of 16:20, 10 January 2018

Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P

  • smiles:
    • C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
  • inchi key:
    • InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
  • common name:
    • 5-enolpyruvoyl-shikimate 3-phosphate
  • molecular weight:
    • 320.149
  • Synonym(s):
    • 3-enolpyruvyl-shikimate 5-phosphate
    • 3-enolpyruvyl-shikimate-5-P
    • 5-O-(1-carboxyvinyl)-3-phosphoshikimate
    • 5-enolpyruvyl-shikimate 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14122&oldid=12458"