Difference between revisions of "Tiso gene 12097"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C...")
(Created page with "Category:Gene == Gene Tiso_gene_12097 == * right end position: ** 3870 * transcription direction: ** POSITIVE * left end position: ** 2 * centisome position: ** 2.74122800...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] ==
+
== Gene Tiso_gene_12097 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
+
** 3870
−
* common name:
+
* transcription direction:
−
** 6-deoxocastasterone
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N
+
** 2
−
* molecular weight:
+
* centisome position:
−
** 450.701   
+
** 2.74122800e-2
 
* Synonym(s):
 
* Synonym(s):
−
** deoxocastasterone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-778]]
+
* Reaction: [[RXN0-5419]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01030127
+
{{#set: right end position=3870}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13870433 13870433]
+
{{#set: left end position=2}}
−
* HMDB : HMDB33984
+
{{#set: centisome position=2.74122800e-2}}
−
* CHEBI:
+
{{#set: reaction associated=RXN0-5419}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20712 20712]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15802 C15802]
+
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: common name=6-deoxocastasterone}}
+
−
{{#set: inchi key=InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N}}
+
−
{{#set: molecular weight=450.701    }}
+
−
{{#set: common name=deoxocastasterone}}
+
−
{{#set: consumed by=RXN-778}}
+

Latest revision as of 19:05, 21 March 2018

Gene Tiso_gene_12097

  • right end position:
    • 3870
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2
  • centisome position:
    • 2.74122800e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12097&oldid=39366"