Difference between revisions of "CPD-8268"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF 5-METHYL-THF] == * smiles: ** CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O |
* common name: | * common name: | ||
− | ** | + | ** dioleoyl phosphatidate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 698.959 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 18:1-18:1-PA |
− | ** | + | ** 1-18:1-2-18:1-phosphatidic acid |
− | ** | + | ** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate |
− | + | ** 1-18:1-2-18:1-phosphatidate | |
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15068]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15043]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627209 71627209] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308] |
− | * | + | * HMDB : HMDB07865 |
− | {{#set: smiles= | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}} |
− | {{#set: common name= | + | {{#set: common name=dioleoyl phosphatidate}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=698.959 }} |
− | {{#set: common name= | + | {{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}} |
− | {{#set: consumed by= | + | {{#set: consumed by=RXN-15068}} |
− | {{#set: produced by= | + | {{#set: produced by=RXN-15043}} |
Latest revision as of 19:05, 21 March 2018
Contents
Metabolite CPD-8268
- smiles:
- CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
- common name:
- dioleoyl phosphatidate
- inchi key:
- InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
- molecular weight:
- 698.959
- Synonym(s):
- 18:1-18:1-PA
- 1-18:1-2-18:1-phosphatidic acid
- 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
- 1-18:1-2-18:1-phosphatidate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.