Difference between revisions of "GAMA-TOCOPHEROL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * smiles: ** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == |
* smiles: | * smiles: | ||
− | ** CC( | + | ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C)) |
* common name: | * common name: | ||
− | ** | + | ** γ-tocopherol |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 416.686 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7,8-dimethyltocol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92729 92729] |
− | {{#set: smiles=CC( | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.83708.html 83708] |
− | {{#set: inchi key=InChIKey= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18185 18185] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC18185 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02483 C02483] | ||
+ | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))}} | ||
+ | {{#set: common name=γ-tocopherol}} | ||
+ | {{#set: inchi key=InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: common name=7,8-dimethyltocol}} | ||
+ | {{#set: consumed by=TOCOPHEROL-O-METHYLTRANSFERASE-RXN}} |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite GAMA-TOCOPHEROL
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))
- common name:
- γ-tocopherol
- inchi key:
- InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N
- molecular weight:
- 416.686
- Synonym(s):
- 7,8-dimethyltocol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links