Difference between revisions of "CANAVANINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13204 == * Synonym(s): == Reactions associated == * Reaction: TRANS-RXN0-460 ** Source: orthology-creinhardtii ** Source: orthol...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * common name: ** L-cana...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == |
+ | * smiles: | ||
+ | ** C(CC([N+])C(=O)[O-])ONC(=[N+])N | ||
+ | * common name: | ||
+ | ** L-canavanine | ||
+ | * inchi key: | ||
+ | ** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O | ||
+ | * molecular weight: | ||
+ | ** 177.183 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** canavanine | ||
+ | ** 2-amino-4-(guanidinooxy)butyrate | ||
+ | ** 2-amino-4-(guanidinooxy)butyric acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-22]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 543-38-4 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185] | ||
+ | * HMDB : HMDB02706 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308] | ||
+ | {{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}} | ||
+ | {{#set: common name=L-canavanine}} | ||
+ | {{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}} | ||
+ | {{#set: molecular weight=177.183 }} | ||
+ | {{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}} | ||
+ | {{#set: produced by=RXN-22}} |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CANAVANINE
- smiles:
- C(CC([N+])C(=O)[O-])ONC(=[N+])N
- common name:
- L-canavanine
- inchi key:
- InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
- molecular weight:
- 177.183
- Synonym(s):
- canavanine
- 2-amino-4-(guanidinooxy)butyrate
- 2-amino-4-(guanidinooxy)butyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.