Difference between revisions of "L-GULONATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** L-gulona...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
+
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3035 TAX-3035]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
+
 
* common name:
 
* common name:
−
** TCA cycle IV (2-oxoglutarate decarboxylase)
+
** L-gulonate
 +
* inchi key:
 +
** InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M
 +
* molecular weight:
 +
** 195.149   
 
* Synonym(s):
 
* Synonym(s):
−
** citric acid cycle
+
** gulonate
−
** tricarboxylic acid cycle
+
−
** Szent-Gyorgyi-Krebs cycle
+
−
** Krebs cycle
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''9''' reactions found over '''11''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[ACONITATEDEHYDR-RXN]]
+
* [[RXN-8783]]
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_13007]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-synechocystis]]
+
−
* [[ACONITATEHYDR-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_13007]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[CITSYN-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Tiso_gene_18030]]
+
−
*** [[Tiso_gene_9601]]
+
−
*** [[Tiso_gene_9603]]
+
−
*** [[Tiso_gene_9602]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[FUMHYDR-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_3691]]
+
−
*** [[Tiso_gene_6720]]
+
−
** 6 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[ISOCIT-CLEAV-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_14008]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[ISOCITDEH-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_18262]]
+
−
*** [[Tiso_gene_10809]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[MALATE-DEH-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_2323]]
+
−
*** [[Tiso_gene_1990]]
+
−
** 7 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[MALSYN-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_14377]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[SUCCSEMIALDDEHYDROG-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_6952]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-synechocystis]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7774 RXN-7774]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-1117}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-3035}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857680 6857680]
−
{{#set: taxonomic range=TAX-1224}}
+
* CHEMSPIDER:
−
{{#set: taxonomic range=TAX-201174}}
+
** [http://www.chemspider.com/Chemical-Structure.5257015.html 5257015]
−
{{#set: common name=TCA cycle IV (2-oxoglutarate decarboxylase)}}
+
* CHEBI:
−
{{#set: common name=citric acid cycle|tricarboxylic acid cycle|Szent-Gyorgyi-Krebs cycle|Krebs cycle}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13115 13115]
−
{{#set: reaction found=9}}
+
* METABOLIGHTS : MTBLC13115
−
{{#set: total reaction=11}}
+
* LIGAND-CPD:
−
{{#set: completion rate=82.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00800 C00800]
 +
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
 +
{{#set: common name=L-gulonate}}
 +
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M}}
 +
{{#set: molecular weight=195.149    }}
 +
{{#set: common name=gulonate}}
 +
{{#set: produced by=RXN-8783}}

Latest revision as of 19:08, 21 March 2018

Metabolite L-GULONATE

  • smiles:
    • C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
  • common name:
    • L-gulonate
  • inchi key:
    • InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M
  • molecular weight:
    • 195.149
  • Synonym(s):
    • gulonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-GULONATE&oldid=39737"