Difference between revisions of "RXN-10777"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * common name: ** dopamine * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10777 RXN-10777] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10777 RXN-10777] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1] | |
| − | + | ||
| − | + | ||
| − | * | + | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[PAPS]][c] '''+''' 1 [[SEROTONIN]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-11665]][c] '''+''' 1 [[3-5-ADP]][c] |
| − | == | + | * With common name(s): |
| − | == | + | ** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 serotonin[c] '''=>''' 1 H+[c] '''+''' 1 serotonin O-sulfate[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_5505]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6313]], serotonin degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313] | ||
| + | ** '''6''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.8.2.1}} | |
| − | + | {{#set: gene associated=Tiso_gene_5505}} | |
| − | + | {{#set: in pathway=PWY-6313}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:09, 21 March 2018
Contents
Reaction RXN-10777
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 3'-phosphoadenylyl-sulfate[c] + 1 serotonin[c] => 1 H+[c] + 1 serotonin O-sulfate[c] + 1 adenosine 3',5'-bisphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5505
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
