Difference between revisions of "PWY-1801"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1801 PWY-1801] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1801 PWY-1801] ==
* smiles:
+
* taxonomic range:
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** ent-kaurenol
+
** formaldehyde oxidation II (glutathione-dependent)
* inchi key:
+
** InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
+
* molecular weight:
+
** 288.472   
+
 
* Synonym(s):
 
* Synonym(s):
** ent-kaur-16-en-19-ol
+
** formaldehyde oxidation II (GSH-dependent)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-5242]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-2962]]
* [[1.14.13.78-RXN]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_18459]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10446]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2961 RXN-2961]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443465 443465]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-1801 PWY-1801]
* HMDB : HMDB36727
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29611 29611]
+
{{#set: common name=formaldehyde oxidation II (glutathione-dependent)}}
* LIGAND-CPD:
+
{{#set: common name=formaldehyde oxidation II (GSH-dependent)}}
** [http://www.genome.jp/dbget-bin/www_bget?C11872 C11872]
+
{{#set: reaction found=2}}
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))}}
+
{{#set: total reaction=3}}
{{#set: common name=ent-kaurenol}}
+
{{#set: completion rate=67.0}}
{{#set: inchi key=InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N}}
+
{{#set: molecular weight=288.472    }}
+
{{#set: common name=ent-kaur-16-en-19-ol}}
+
{{#set: consumed by=RXN-5242}}
+
{{#set: produced by=1.14.13.78-RXN}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-1801

  • taxonomic range:
  • common name:
    • formaldehyde oxidation II (glutathione-dependent)
  • Synonym(s):
    • formaldehyde oxidation II (GSH-dependent)

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links