Difference between revisions of "ENT-KAUR-16-EN-19-OL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1224 RXN-1224] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1224 RXN-1224] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.4.1.M2 EC-2.4.1.M2]
+
** ent-kaurenol
 +
* inchi key:
 +
** InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
 +
* molecular weight:
 +
** 288.472   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-kaur-16-en-19-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-5242]]
−
** 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[UDP-SULFOQUINOVOSE]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SULFOQUINOVOSYLDIACYLGLYCEROL]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[1.14.13.78-RXN]]
−
** 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 UDP-α-D-sulfoquinovopyranose[c] '''=>''' 1 UDP[c] '''+''' 1 H+[c] '''+''' 1 an 6-sulfo-α-D-quinovosyl diacylglycerol[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_7966]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_17894]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_12341]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_11792]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_9428]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_10734]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_412]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_3385]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_19034]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_10863]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_15050]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYQT-4427]], sulfoquinovosyl diacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06867 R06867]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443465 443465]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB36727
−
{{#set: ec number=EC-2.4.1.M2}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_7966|Tiso_gene_17894|Tiso_gene_12341|Tiso_gene_11792|Tiso_gene_9428|Tiso_gene_10734|Tiso_gene_412|Tiso_gene_3385|Tiso_gene_19034|Tiso_gene_10863|Tiso_gene_15050}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29611 29611]
−
{{#set: in pathway=PWYQT-4427}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11872 C11872]
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=ent-kaurenol}}
 +
{{#set: inchi key=InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N}}
 +
{{#set: molecular weight=288.472    }}
 +
{{#set: common name=ent-kaur-16-en-19-ol}}
 +
{{#set: consumed by=RXN-5242}}
 +
{{#set: produced by=1.14.13.78-RXN}}

Latest revision as of 19:10, 21 March 2018

Metabolite ENT-KAUR-16-EN-19-OL

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
  • common name:
    • ent-kaurenol
  • inchi key:
    • InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
  • molecular weight:
    • 288.472
  • Synonym(s):
    • ent-kaur-16-en-19-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ENT-KAUR-16-EN-19-OL&oldid=39902"