Difference between revisions of "Tiso gene 11849"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_11849 == * right end position: ** 7441 * transcription direction: ** POSITIVE * left end position: ** 5768 * centisome position: ** 77.1019...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] ==
+
== Gene Tiso_gene_11849 ==
* smiles:
+
* right end position:
** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
+
** 7441
* common name:
+
* transcription direction:
** cob(I)yrinate a,c-diamide
+
** POSITIVE
* inchi key:
+
* left end position:
** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
+
** 5768
* molecular weight:
+
* centisome position:
** 931.9    
+
** 77.10199    
 
* Synonym(s):
 
* Synonym(s):
** cob(I)yrinic acid a,c-diamide
 
** Cob(I)yrinate diamide
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[R344-RXN]]
+
* Reaction: [[2.1.1.143-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-4021]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-2541]]
 +
* [[PWY-7155]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=7441}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689]
+
{{#set: transcription direction=POSITIVE}}
* HMDB : HMDB06904
+
{{#set: left end position=5768}}
* CHEBI:
+
{{#set: centisome position=77.10199   }}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575]
+
{{#set: reaction associated=2.1.1.143-RXN|RXN-4021}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-2541|PWY-7155}}
** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505]
+
{{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}}
+
{{#set: common name=cob(I)yrinate a,c-diamide}}
+
{{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}}
+
{{#set: molecular weight=931.9   }}
+
{{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}}
+
{{#set: consumed by=R344-RXN}}
+

Latest revision as of 19:10, 21 March 2018

Gene Tiso_gene_11849

  • right end position:
    • 7441
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5768
  • centisome position:
    • 77.10199
  • Synonym(s):

Reactions associated

Pathways associated

External links