Difference between revisions of "2.4.1.46-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * common name: ** L-glutamate * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.46-RXN 2.4.1.46-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** monogalactosyldiacylg...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.46-RXN 2.4.1.46-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** monogalactosyldiacylglycerol_synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.46 EC-2.4.1.46] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[CPD-14553]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[D-Galactosyl-12-diacyl-glycerols]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 UDP-α-D-galactose[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] '''=>''' 1 UDP[c] '''+''' 1 a 1,2-diacyl-3-O-(β-D-galactopyranosyl)-sn-glycerol[c] '''+''' 1 H+[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_4096]] | |
− | + | ** Source: [[orthology-athaliana]] | |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | + | * Gene: [[Tiso_gene_9530]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: AUTOMATED-NAME-MATCH | |
− | + | ** Source: [[orthology-athaliana]] | |
− | + | == Pathways == | |
− | * | + | * [[PWY-401]], galactolipid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] |
− | + | ** '''5''' reactions found over '''5''' reactions in the full pathway | |
− | * | + | == Reconstruction information == |
− | * | + | * Category: [[orthology]] |
− | + | ** Source: [[orthology-athaliana]] | |
− | + | *** Tool: [[pantograph]] | |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | + | *** Tool: [[pantograph]] | |
− | + | * Category: [[annotation]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Tool: [[pathwaytools]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14945 14945] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02691 R02691] |
− | + | * UNIPROT: | |
− | + | ** [http://www.uniprot.org/uniprot/O81770 O81770] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P93115 P93115] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/O82730 O82730] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www. | + | {{#set: common name=monogalactosyldiacylglycerol_synthase}} |
− | * | + | {{#set: ec number=EC-2.4.1.46}} |
− | ** [http://www. | + | {{#set: gene associated=Tiso_gene_4096|Tiso_gene_9530}} |
− | + | {{#set: in pathway=PWY-401}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: common name= | + | {{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:10, 21 March 2018
Contents
Reaction 2.4.1.46-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- monogalactosyldiacylglycerol_synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-14553[c] + 1 DIACYLGLYCEROL[c] => 1 UDP[c] + 1 D-Galactosyl-12-diacyl-glycerols[c] + 1 PROTON[c]
- With common name(s):
- 1 UDP-α-D-galactose[c] + 1 a 1,2-diacyl-sn-glycerol[c] => 1 UDP[c] + 1 a 1,2-diacyl-3-O-(β-D-galactopyranosyl)-sn-glycerol[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_4096
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Gene: Tiso_gene_9530
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
Pathways
- PWY-401, galactolipid biosynthesis I: PWY-401
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links