Difference between revisions of "CPD-4125"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
+
 
* common name:
 
* common name:
** sucrose degradation I (sucrose phosphotransferase)
+
** avenasterol
 +
* inchi key:
 +
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-4209]]
* [[FRUCTOKINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 3 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_1303]]
+
*** [[Tiso_gene_17974]]
+
*** [[Tiso_gene_3107]]
+
** 4 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-creinhardtii]]
+
*** [[annotation-experimental_annotation]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.26-RXN 3.2.1.26-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=SUCROSEPHOSPHO-RXN SUCROSEPHOSPHO-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-1224}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736]
{{#set: taxonomic range=TAX-1239}}
+
* HMDB : HMDB06851
{{#set: common name=sucrose degradation I (sucrose phosphotransferase)}}
+
* LIGAND-CPD:
{{#set: reaction found=1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
{{#set: total reaction=3}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: completion rate=33.0}}
+
{{#set: common name=avenasterol}}
 +
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: consumed by=RXN-4209}}

Latest revision as of 19:11, 21 March 2018

Metabolite CPD-4125

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • avenasterol
  • inchi key:
    • InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.