Difference between revisions of "CPD-4573"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PBDHh G6PBDHh] == * direction: ** LEFT-TO-RIGHT * common name: ** glucose 6-phosphate dehydrogena...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PBDHh G6PBDHh] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 
* common name:
 
* common name:
−
** glucose 6-phosphate dehydrogenase (g6p-B)
+
** 14-oxolanosterol
 +
* inchi key:
 +
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 440.708   
 
* Synonym(s):
 
* Synonym(s):
 +
** 14-oxo-lanosterol
 +
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-305]]
−
** 1.0 [[GLC-6-P]][h] '''+''' 1.0 [[NADP]][h] '''=>''' 1.0 [[PROTON]][h] '''+''' 1.0 [[D-6-P-GLUCONO-DELTA-LACTONE]][h] '''+''' 1.0 [[NADPH]][h]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-304]]
−
** 1.0 β-D-glucose 6-phosphate[h] '''+''' 1.0 NADP+[h] '''=>''' 1.0 H+[h] '''+''' 1.0 6-phospho D-glucono-1,5-lactone[h] '''+''' 1.0 NADPH[h]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_14877]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=glucose 6-phosphate dehydrogenase (g6p-B)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
−
{{#set: gene associated=Tiso_gene_14877}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
{{#set: in pathway=}}
+
{{#set: common name=14-oxolanosterol}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: molecular weight=440.708    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-305}}
 +
{{#set: produced by=RXN66-304}}

Latest revision as of 19:11, 21 March 2018

Metabolite CPD-4573

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • common name:
    • 14-oxolanosterol
  • inchi key:
    • InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
  • molecular weight:
    • 440.708
  • Synonym(s):
    • 14-oxo-lanosterol
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4573&oldid=40091"