Difference between revisions of "4-AMINO-4-DEOXYCHORISMATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12726 RXN-12726] == * direction: ** LEFT-TO-RIGHT * common name: ** cog0031:_cysteine_synthase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12726 RXN-12726] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
 
* common name:
 
* common name:
−
** cog0031:_cysteine_synthase
+
** 4-amino-4-deoxychorismate
−
** cysteine_synthase
+
* inchi key:
−
** cysteine
+
** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.5.1.47 EC-2.5.1.47]
+
** 224.193   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-678]][c] '''+''' 1 [[ACETYLSERINE]][c] '''=>''' 1 [[L-SELENOCYSTEINE]][c] '''+''' 1 [[ACET]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[ADCLY-RXN]]
−
** 1 hydrogen selenide[c] '''+''' 1 O-acetyl-L-serine[c] '''=>''' 1 L-selenocysteine[c] '''+''' 1 acetate[c] '''+''' 1 H+[c]
+
* [[PABASYN-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_12184]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_6110]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-athaliana]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_7852]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-athaliana]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_819]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_17043]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_2283]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6936]], seleno-amino acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 97279-79-3
−
{{#set: common name=cog0031:_cysteine_synthase}}
+
* PUBCHEM:
−
{{#set: common name=cysteine_synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632]
−
{{#set: common name=cysteine}}
+
* CHEBI:
−
{{#set: ec number=EC-2.5.1.47}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406]
−
{{#set: gene associated=Tiso_gene_12184|Tiso_gene_6110|Tiso_gene_7852|Tiso_gene_819|Tiso_gene_17043|Tiso_gene_2283}}
+
* BIGG : 4adcho
−
{{#set: in pathway=PWY-6936}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology|annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355]
−
{{#set: reconstruction source=annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|orthology-creinhardtii|orthology-esiliculosus}}
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common name=4-amino-4-deoxychorismate}}
 +
{{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}}
 +
{{#set: molecular weight=224.193    }}
 +
{{#set: reversible reaction associated=ADCLY-RXN|PABASYN-RXN}}

Latest revision as of 19:12, 21 March 2018

Metabolite 4-AMINO-4-DEOXYCHORISMATE

  • smiles:
    • C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
  • common name:
    • 4-amino-4-deoxychorismate
  • inchi key:
    • InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
  • molecular weight:
    • 224.193
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=4-AMINO-4-DEOXYCHORISMATE&oldid=40114"