Difference between revisions of "CPD-13205"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.60-RXN 2.7.7.60-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-c-methyl-d-erythrit...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O |
* common name: | * common name: | ||
− | ** | + | ** cellotetraose |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N |
+ | * molecular weight: | ||
+ | ** 666.583 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12305]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.148760.html 148760] |
− | {{#set: | + | {{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}} |
− | + | {{#set: common name=cellotetraose}} | |
− | + | {{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}} | |
− | {{#set: common name= | + | {{#set: molecular weight=666.583 }} |
− | {{#set: | + | {{#set: consumed by=RXN-12305}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite CPD-13205
- smiles:
- C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
- common name:
- cellotetraose
- inchi key:
- InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
- molecular weight:
- 666.583
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links