Difference between revisions of "RXN-13064"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * c...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13064 RXN-13064] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13064 RXN-13064] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-9446]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[D-mannopyranose]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 1,5-anhydro-D-mannitol[c] '''=>''' 1 H2O[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 D-mannopyranose[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | + | * Gene: [[Tiso_gene_1035]] | |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY-6992]], 1,5-anhydrofructose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992] |
− | * [[ | + | ** '''3''' reactions found over '''5''' reactions in the full pathway |
− | + | == Reconstruction information == | |
− | * | + | * Category: [[orthology]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | *** Tool: [[pantograph]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.14.14.1}} | |
− | + | {{#set: gene associated=Tiso_gene_1035}} | |
− | + | {{#set: in pathway=PWY-6992}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:13, 21 March 2018
Contents
Reaction RXN-13064
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 Red-NADPH-Hemoprotein-Reductases[c] + 1 CPD-9446[c] => 1 WATER[c] + 1 Ox-NADPH-Hemoprotein-Reductases[c] + 1 D-mannopyranose[c]
- With common name(s):
- 1 oxygen[c] + 1 a reduced [NADPH-hemoprotein reductase][c] + 1 1,5-anhydro-D-mannitol[c] => 1 H2O[c] + 1 an oxidized [NADPH-hemoprotein reductase][c] + 1 D-mannopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1035
- Source: orthology-esiliculosus
Pathways
- PWY-6992, 1,5-anhydrofructose degradation: PWY-6992
- 3 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus