Difference between revisions of "MALTOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOSE MALTOSE] == * common name: ** maltose * Synonym(s): ** α-D-glucopyranose-(1→...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOSE MALTOSE] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** maltose |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α-D-glucopyranose-(1→4)-D-glucopyranose |
− | + | ** maltose | |
− | + | ||
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14349]] | ||
+ | * [[RXN-15910]] | ||
+ | * [[RXN-14350]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-5183]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=maltose}} | |
− | + | {{#set: common name=α-D-glucopyranose-(1→4)-D-glucopyranose|maltose}} | |
− | + | {{#set: consumed by=RXN-14349|RXN-15910|RXN-14350}} | |
− | + | {{#set: produced by=RXN0-5183}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:13, 21 March 2018
Contents
Metabolite MALTOSE
- common name:
- maltose
- Synonym(s):
- α-D-glucopyranose-(1→4)-D-glucopyranose
- maltose