Difference between revisions of "CPD-8607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18092 RXN-18092] == * direction: ** LEFT-TO-RIGHT * common name: ** gamma-glutamyl_transferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18092 RXN-18092] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 
* common name:
 
* common name:
−
** gamma-glutamyl_transferase
+
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
+
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 444.74   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-12]]
−
** 1 [[GLYCYLGLYCINE]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[CYS-GLY]][c] '''+''' 1 [[CPD-19395]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-11]]
−
** 1 glycyl-glycine[c] '''+''' 1 glutathione[c] '''=>''' 1 L-cysteinyl-glycine[c] '''+''' 1 γ-L-glutamyl-glycylglycine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_12321]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=gamma-glutamyl_transferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698821 15698821]
−
{{#set: ec number=EC-2.3.2.2}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_12321}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87057 87057]
−
{{#set: in pathway=}}
+
* HMDB : HMDB12160
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
 +
{{#set: molecular weight=444.74    }}
 +
{{#set: consumed by=RXN66-12}}
 +
{{#set: produced by=RXN66-11}}

Latest revision as of 19:13, 21 March 2018

Metabolite CPD-8607

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • common name:
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
  • inchi key:
    • InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
  • molecular weight:
    • 444.74
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8607&oldid=40278"