Difference between revisions of "Tiso gene 14441"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * common nam...") |
(Created page with "Category:Gene == Gene Tiso_gene_14441 == * Synonym(s): == Reactions associated == * Reaction: 2.7.1.121-RXN ** Source: orthology-creinhardtii * Reaction: GLYCER...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_14441 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[2.7.1.121-RXN]] |
| − | + | ** Source: [[orthology-creinhardtii]] | |
| − | == | + | * Reaction: [[GLYCERONE-KINASE-RXN]] |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | * [[ | + | *** Assignment: ec-number |
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-6131]] | ||
| + | * [[P185-PWY]] | ||
| + | * [[GLYCEROLMETAB-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=2.7.1.121-RXN|GLYCERONE-KINASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6131|P185-PWY|GLYCEROLMETAB-PWY}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:14, 21 March 2018
Gene Tiso_gene_14441
- Synonym(s):
Reactions associated
- Reaction: 2.7.1.121-RXN
- Source: orthology-creinhardtii
- Reaction: GLYCERONE-KINASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
