Difference between revisions of "CPD-11404"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * common name: ** 3-ace...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * co...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) |
* common name: | * common name: | ||
| − | ** 3- | + | ** 3,3',5-triiodothyroacetate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 620.928 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 3- | + | ** 3,3',5-triiodothyroacetic acid |
| + | ** Triac | ||
| + | ** Tiratricol | ||
| + | ** Tiracana | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10618]] | ||
| + | * [[RXN-10619]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629] |
| − | {{#set: smiles= | + | * CHEMSPIDER: |
| − | {{#set: common name=3- | + | ** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}} |
| − | {{#set: molecular weight= | + | {{#set: common name=3,3',5-triiodothyroacetate}} |
| − | {{#set: common name=3- | + | {{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=620.928 }} |
| + | {{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}} | ||
| + | {{#set: consumed by=RXN-10618|RXN-10619}} | ||
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite CPD-11404
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
- common name:
- 3,3',5-triiodothyroacetate
- inchi key:
- InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
- molecular weight:
- 620.928
- Synonym(s):
- 3,3',5-triiodothyroacetic acid
- Triac
- Tiratricol
- Tiracana
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))" cannot be used as a page name in this wiki.
