Difference between revisions of "GLUDEG-II-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUDEG-II-PWY GLUDEG-II-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUDEG-II-PWY GLUDEG-II-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] | ||
* common name: | * common name: | ||
− | ** ( | + | ** L-glutamate degradation VII (to butanoate) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** L-glutamate fermentation |
+ | ** mesaconate pathway | ||
+ | ** L-glutamate degradation VII (to butyrate) | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''6''' reactions in the full pathway |
− | * [[ | + | * [[CENTFERM-PWY]] |
− | + | ** 0 associated gene: | |
− | * [[ | + | * [[HYDROG-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_4288]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-5087 PWY-5087] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-5087 PWY-5087] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=L-glutamate degradation VII (to butanoate)}} | |
− | + | {{#set: common name=L-glutamate fermentation|mesaconate pathway|L-glutamate degradation VII (to butyrate)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=33.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Pathway GLUDEG-II-PWY
- taxonomic range:
- common name:
- L-glutamate degradation VII (to butanoate)
- Synonym(s):
- L-glutamate fermentation
- mesaconate pathway
- L-glutamate degradation VII (to butyrate)
Reaction(s) found
2 reactions found over 6 reactions in the full pathway
- CENTFERM-PWY
- 0 associated gene:
- HYDROG-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: