Difference between revisions of "SSNOm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * common name: ** trans-cinnamate...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SSNOm SSNOm] == * direction: ** LEFT-TO-RIGHT * common name: ** succinate-semialdehyde:NAD+ oxidore...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SSNOm SSNOm] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C=CC1(=CC=CC=C1)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** trans-cinnamate
+
** succinate-semialdehyde:NAD+ oxidoreductase, mitochondria
−
* inchi key:
+
−
** InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M
+
−
* molecular weight:
+
−
** 147.153   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-phenylacrylic acid
 
−
** 3-phenyl-2-propenoic acid
 
−
** cinnamic acid
 
−
** cinnamate
 
−
** trans-cinnamic acid
 
−
** (E)-cinnamate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-2001]]
+
* With identifiers:
−
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
+
** 1.0 [[NAD]][m] '''+''' 1.0 [[WATER]][m] '''+''' 1.0 [[SUCC-S-ALD]][m] '''=>''' 2.0 [[PROTON]][m] '''+''' 1.0 [[SUC]][m] '''+''' 1.0 [[NADH]][m]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 NAD+[m] '''+''' 1.0 H2O[m] '''+''' 1.0 succinate semialdehyde[m] '''=>''' 2.0 H+[m] '''+''' 1.0 succinate[m] '''+''' 1.0 NADH[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6952]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 140-10-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : cinnm
+
{{#set: common name=succinate-semialdehyde:NAD+ oxidoreductase, mitochondria}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_6952}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5957728 5957728]
+
{{#set: in pathway=}}
−
* HMDB : HMDB00930
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00423 C00423]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4762929.html 4762929]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15669 15669]
+
−
* METABOLIGHTS : MTBLC15669
+
−
{{#set: smiles=C(=O)([O-])C=CC1(=CC=CC=C1)}}
+
−
{{#set: common name=trans-cinnamate}}
+
−
{{#set: inchi key=InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M}}
+
−
{{#set: molecular weight=147.153    }}
+
−
{{#set: common name=β-phenylacrylic acid|3-phenyl-2-propenoic acid|cinnamic acid|cinnamate|trans-cinnamic acid|(E)-cinnamate}}
+
−
{{#set: consumed by=RXN-2001|TRANS-CINNAMATE-4-MONOOXYGENASE-RXN}}
+

Latest revision as of 19:15, 21 March 2018

Reaction SSNOm

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • succinate-semialdehyde:NAD+ oxidoreductase, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NAD+[m] + 1.0 H2O[m] + 1.0 succinate semialdehyde[m] => 2.0 H+[m] + 1.0 succinate[m] + 1.0 NADH[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SSNOm&oldid=40424"