Difference between revisions of "PWY0-1573"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * common name: ** uri...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1573 PWY0-1573] == * common name: ** nitrate reduction VIIIb (dissimilatory) * Synonym(s): ** NA...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1573 PWY0-1573] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** nitrate reduction VIIIb (dissimilatory) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** NADH to nitrate reductase electron transfer | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN0-5330]] |
| − | * | + | ** 2 associated gene(s): |
| − | * | + | *** [[Tiso_gene_18172]] |
| − | * | + | *** [[Tiso_gene_18831]] |
| − | * | + | ** 2 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-in-silico_annotation]] |
| − | * | + | *** [[orthology-esiliculosus]] |
| − | * | + | == Reaction(s) not found == |
| − | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7124 RXN0-7124] |
| − | * | + | |
| − | + | ||
| − | * [[ | + | |
| − | * [[ | + | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1573 PWY0-1573] | |
| − | + | {{#set: common name=nitrate reduction VIIIb (dissimilatory)}} | |
| − | + | {{#set: common name=NADH to nitrate reductase electron transfer}} | |
| − | ** [http:// | + | {{#set: reaction found=1}} |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:15, 21 March 2018
Pathway PWY0-1573
- common name:
- nitrate reduction VIIIb (dissimilatory)
- Synonym(s):
- NADH to nitrate reductase electron transfer
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN0-5330
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
