Difference between revisions of "CPD-8058"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-358 CPD-358] == * smiles: ** CC([CH]=O)O * common name: ** (R)-lactaldehyde * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * common na...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == |
* smiles: | * smiles: | ||
− | ** | + | ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) |
* common name: | * common name: | ||
− | ** | + | ** D-galactosylononitol |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 356.326 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** galactosyl sequoyitol |
− | ** D- | + | ** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8281]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605] |
− | + | {{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}} | |
− | + | {{#set: common name=D-galactosylononitol}} | |
− | + | {{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}} | |
− | + | {{#set: molecular weight=356.326 }} | |
− | + | {{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}} | |
− | + | {{#set: produced by=RXN-8281}} | |
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: common name= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name=D- | + | |
− | {{#set: | + |
Latest revision as of 19:16, 21 March 2018
Contents
Metabolite CPD-8058
- smiles:
- COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
- common name:
- D-galactosylononitol
- inchi key:
- InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
- molecular weight:
- 356.326
- Synonym(s):
- galactosyl sequoyitol
- O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: