Difference between revisions of "CPD-14601"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1517 PWY0-1517] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * c...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1517 PWY0-1517] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** sedoheptulose bisphosphate bypass
+
** mycophenolate
 +
* inchi key:
 +
** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
 +
* molecular weight:
 +
** 319.333   
 
* Synonym(s):
 
* Synonym(s):
 +
** mycophenolic acid
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-13608]]
* [[RXN0-6541]]
+
* [[RXN-13607]]
** 1 associated gene(s):
+
== Reaction(s) known to produce the compound ==
*** [[Tiso_gene_5733]]
+
== Reaction(s) of unknown directionality ==
** 1 reconstruction source(s) associated:
+
*** [[orthology-synechocystis]]
+
* [[SEDOBISALDOL-RXN]]
+
** 4 associated gene(s):
+
*** [[Tiso_gene_14568]]
+
*** [[Tiso_gene_9179]]
+
*** [[Tiso_gene_65]]
+
*** [[Tiso_gene_12272]]
+
** 4 reconstruction source(s) associated:
+
*** [[orthology-athaliana]]
+
*** [[orthology-creinhardtii]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* PUBCHEM:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1517 PWY0-1517]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995]
{{#set: taxonomic range=TAX-2759}}
+
* CHEBI:
{{#set: taxonomic range=TAX-2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932]
{{#set: common name=sedoheptulose bisphosphate bypass}}
+
{{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}}
{{#set: reaction found=2}}
+
{{#set: common name=mycophenolate}}
{{#set: total reaction=2}}
+
{{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}}
{{#set: completion rate=100.0}}
+
{{#set: molecular weight=319.333    }}
 +
{{#set: common name=mycophenolic acid}}
 +
{{#set: consumed by=RXN-13608|RXN-13607}}

Latest revision as of 19:16, 21 March 2018

Metabolite CPD-14601

  • smiles:
    • CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
  • common name:
    • mycophenolate
  • inchi key:
    • InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
  • molecular weight:
    • 319.333
  • Synonym(s):
    • mycophenolic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)" cannot be used as a page name in this wiki.