Difference between revisions of "PHENYLACETATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14268 CPD-14268] == * smiles: ** CCCCCCCCC=CCCCCCCCCCCCCCC(=O)[O-] * common name: ** (15Z)-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * common name: ** phenyl...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(=CC=C(C=C1)CC([O-])=O) |
* common name: | * common name: | ||
| − | ** | + | ** phenylacetate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-M |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 135.142 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-phenylacetate |
| + | ** benzeneacetic acid | ||
| + | ** phenylacetic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[PHENDEHYD-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 103-82-2 | ||
| + | * Wikipedia : Phenylacetic_acid | ||
| + | * BIGG : pac | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4409936 4409936] |
| + | * HMDB : HMDB00209 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C07086 C07086] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3610724.html 3610724] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18401 18401] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC18401 |
| − | {{#set: smiles= | + | {{#set: smiles=C1(=CC=C(C=C1)CC([O-])=O)}} |
| − | {{#set: common name= | + | {{#set: common name=phenylacetate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=135.142 }} |
| − | {{#set: common name= | + | {{#set: common name=2-phenylacetate|benzeneacetic acid|phenylacetic acid}} |
| − | {{#set: | + | {{#set: reversible reaction associated=PHENDEHYD-RXN}} |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite PHENYLACETATE
- smiles:
- C1(=CC=C(C=C1)CC([O-])=O)
- common name:
- phenylacetate
- inchi key:
- InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-M
- molecular weight:
- 135.142
- Synonym(s):
- 2-phenylacetate
- benzeneacetic acid
- phenylacetic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 103-82-2
- Wikipedia : Phenylacetic_acid
- BIGG : pac
- PUBCHEM:
- HMDB : HMDB00209
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18401
"C1(=CC=C(C=C1)CC([O-])=O)" cannot be used as a page name in this wiki.
