Difference between revisions of "MONO-VINYL-PROTOCHLOROPHYLLIDE-A"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9846 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-esiliculosus == Pathways asso...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
| + | * common name: | ||
| + | ** protochlorophyllide a | ||
| + | * molecular weight: | ||
| + | ** 610.951 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** monovinyl protochlorophyllide a | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[R03845]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| + | * [[RXN1F-10]] | ||
== External links == | == External links == | ||
| − | {{#set: reaction associated= | + | * CAS : 14751-08-7 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448] | ||
| + | * HMDB : HMDB31148 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880] | ||
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
| + | {{#set: common name=protochlorophyllide a}} | ||
| + | {{#set: molecular weight=610.951 }} | ||
| + | {{#set: common name=monovinyl protochlorophyllide a}} | ||
| + | {{#set: consumed by=R03845}} | ||
| + | {{#set: reversible reaction associated=RXN1F-10}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- protochlorophyllide a
- molecular weight:
- 610.951
- Synonym(s):
- monovinyl protochlorophyllide a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
