Difference between revisions of "Protein-L-Asparagine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * common name: ** 3-ace...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Asparagine Protein-L-Asparagine] == * common name: ** a [protein]-L-asparagine * Syno...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Asparagine Protein-L-Asparagine] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [protein]-L-asparagine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.4.1.119-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [protein]-L-asparagine}} | |
| − | + | {{#set: consumed by=2.4.1.119-RXN}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite Protein-L-Asparagine
- common name:
- a [protein]-L-asparagine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-asparagine" cannot be used as a page name in this wiki.
