Difference between revisions of "RXN-10038"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * common...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10038 RXN-10038] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10038 RXN-10038] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.164 EC-2.7.1.164] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[L-seryl-SEC-tRNAs]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[O-phospho-L-seryl-tRNASecs]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 an L-seryl-[tRNAsec][c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 an O-phospho-L-seryl-[tRNASec][c] | |
− | * | + | |
− | + | == Genes associated with this reaction == | |
− | + | == Pathways == | |
− | * [[ | + | * [[PWY-6281]], L-selenocysteine biosynthesis II (archaea and eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6281 PWY-6281] |
− | + | ** '''4''' reactions found over '''4''' reactions in the full pathway | |
− | * | + | == Reconstruction information == |
− | == | + | * Category: [[annotation]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Tool: [[pathwaytools]] |
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08223 R08223] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-2.7.1.164}} | |
− | + | {{#set: in pathway=PWY-6281}} | |
− | * LIGAND- | + | {{#set: reconstruction category=annotation}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:20, 21 March 2018
Contents
Reaction RXN-10038
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-seryl-SEC-tRNAs[c] + 1 ATP[c] <=> 1 ADP[c] + 1 PROTON[c] + 1 O-phospho-L-seryl-tRNASecs[c]
- With common name(s):
- 1 an L-seryl-[tRNAsec][c] + 1 ATP[c] <=> 1 ADP[c] + 1 H+[c] + 1 an O-phospho-L-seryl-[tRNASec][c]
Genes associated with this reaction
Pathways
- PWY-6281, L-selenocysteine biosynthesis II (archaea and eukaryotes): PWY-6281
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: