Difference between revisions of "GUANOSINE-5DP-3DP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACHMSSELCYSLh ACHMSSELCYSLh] == * direction: ** LEFT-TO-RIGHT * common name: ** O-Acetylhomoserine...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACHMSSELCYSLh ACHMSSELCYSLh] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
 
* common name:
 
* common name:
** O-Acetylhomoserine succinate-lyase (adding cysteine), chloroplast
+
** ppGpp
 +
* inchi key:
 +
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
 +
* molecular weight:
 +
** 598.123   
 
* Synonym(s):
 
* Synonym(s):
 +
** guanosine tetraphosphate
 +
** guanosine 5'-diphosphate,3'-diphosphate
 +
** guanosine 3',5'-bispyrophosphate
 +
** guanosine 3',5'-bis(diphosphate)
 +
** guanosine 3'-diphosphate 5'-diphosphate
 +
** magic spot
 +
** guanosine-5',3'-tetraphosphate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[PPGPPSYN-RXN]]
** 1.0 [[CPD-667]][h] '''+''' 1.0 [[L-SELENOCYSTEINE]][h] '''=>''' 1.0 [[ACET]][h] '''+''' 1.0 [[CPD-13717]][h]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[GDPPYPHOSKIN-RXN]]
** 1.0 O-acetyl-L-homoserine[h] '''+''' 1.0 L-selenocysteine[h] '''=>''' 1.0 acetate[h] '''+''' 1.0 L-selenocystathionine[h]
+
== Reaction(s) of unknown directionality ==
 
+
* [[GBDP]]
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Tiso_gene_3732]]
+
** Source: [[orthology-creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-creinhardtii]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB04022
{{#set: common name=O-Acetylhomoserine succinate-lyase (adding cysteine), chloroplast}}
+
* PUBCHEM:
{{#set: gene associated=Tiso_gene_3732}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
{{#set: in pathway=}}
+
* HMDB : HMDB59638
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
{{#set: reconstruction source=orthology-creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
{{#set: reconstruction tool=pantograph}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
 +
* BIGG : ppgpp
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: common name=ppGpp}}
 +
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
 +
{{#set: molecular weight=598.123    }}
 +
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
 +
{{#set: consumed by=PPGPPSYN-RXN}}
 +
{{#set: produced by=GDPPYPHOSKIN-RXN}}
 +
{{#set: reversible reaction associated=GBDP}}

Latest revision as of 20:20, 21 March 2018

Metabolite GUANOSINE-5DP-3DP

  • smiles:
    • C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • common name:
    • ppGpp
  • inchi key:
    • InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
  • molecular weight:
    • 598.123
  • Synonym(s):
    • guanosine tetraphosphate
    • guanosine 5'-diphosphate,3'-diphosphate
    • guanosine 3',5'-bispyrophosphate
    • guanosine 3',5'-bis(diphosphate)
    • guanosine 3'-diphosphate 5'-diphosphate
    • magic spot
    • guanosine-5',3'-tetraphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.