Difference between revisions of "PWY-699"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * common name: ** 3,4-dihydroxybenz...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699] ==
−
* smiles:
+
* taxonomic range:
−
** C(C1(C=C(C(=CC=1)O)O))=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
 
* common name:
 
* common name:
−
** 3,4-dihydroxybenzaldehyde
+
** brassinosteroid biosynthesis I
−
* inchi key:
+
−
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 138.123   
+
 
* Synonym(s):
 
* Synonym(s):
−
** protocatechualdehyde
 
−
** 3,4-dihydroxybenzyl aldehyde
 
−
** rancinamycin IV
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''11''' reactions found over '''25''' reactions in the full pathway
−
* [[RXN-8872]]
+
* [[RXN-11535]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_3577]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-4241]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_3577]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-711]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_14327]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[RXN-715]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_3577]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-716]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_3577]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-717]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_3577]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-773]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3577]]
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-774]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_3577]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-775]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3577]]
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-778]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3577]]
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-779]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3577]]
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11536 RXN-11536]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16171 RXN-16171]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16172 RXN-16172]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16173 RXN-16173]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-709 RXN-709]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-710 RXN-710]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-712 RXN-712]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-713 RXN-713]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-714 RXN-714]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-718 RXN-718]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-719 RXN-719]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-720 RXN-720]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-776 RXN-776]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-777 RXN-777]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-699 PWY-699]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-3193}}
−
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
+
{{#set: common name=brassinosteroid biosynthesis I}}
−
* HMDB : HMDB59965
+
{{#set: reaction found=11}}
−
* CHEBI:
+
{{#set: total reaction=25}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
+
{{#set: completion rate=44.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
+
−
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
+
−
{{#set: common name=3,4-dihydroxybenzaldehyde}}
+
−
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=138.123    }}
+
−
{{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
+
−
{{#set: produced by=RXN-8872}}
+

Latest revision as of 19:20, 21 March 2018

Pathway PWY-699

  • taxonomic range:
  • common name:
    • brassinosteroid biosynthesis I
  • Synonym(s):

Reaction(s) found

11 reactions found over 25 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-699&oldid=41030"