Difference between revisions of "Tiso gene 4653"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * inchi key: ** InChIKey=WKZWTZT...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=C(C1(CC(C(CC1)(O)C)O))C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N |
* common name: | * common name: | ||
− | ** ( | + | ** (1R,2R,4S)-limonene-1,2-diol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 170.251 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (1S,2S,4R)-menth-8-ene-1,2-diol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9413]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19082 C19082] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.9392549.html 9392549] |
− | {{#set: common name=( | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50244 50244] |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11217495 11217495] | ||
+ | {{#set: smiles=C=C(C1(CC(C(CC1)(O)C)O))C}} | ||
+ | {{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N}} | ||
+ | {{#set: common name=(1R,2R,4S)-limonene-1,2-diol}} | ||
+ | {{#set: molecular weight=170.251 }} | ||
+ | {{#set: common name=(1S,2S,4R)-menth-8-ene-1,2-diol}} | ||
+ | {{#set: produced by=RXN-9413}} |
Revision as of 16:22, 10 January 2018
Contents
Metabolite CPD-10055
- smiles:
- C=C(C1(CC(C(CC1)(O)C)O))C
- inchi key:
- InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N
- common name:
- (1R,2R,4S)-limonene-1,2-diol
- molecular weight:
- 170.251
- Synonym(s):
- (1S,2S,4R)-menth-8-ene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links