Difference between revisions of "CPD-15818"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7176 PWY-7176] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ribose...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** [CH](=O)C(O)C(O)C(O)CO |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehydo-D-ribose |
| + | * inchi key: | ||
| + | ** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N | ||
| + | * molecular weight: | ||
| + | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14883]] | |
| − | + | * [[RXN-14882]] | |
| − | + | * [[RXN0-5305]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110] |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014] | |
| − | {{#set: | + | * METABOLIGHTS : MTBLC47014 |
| − | {{#set: common name= | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} |
| − | {{#set: | + | {{#set: common name=aldehydo-D-ribose}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=150.131 }} |
| + | {{#set: reversible reaction associated=RXN-14883|RXN-14882|RXN0-5305}} | ||
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-15818
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- common name:
- aldehydo-D-ribose
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.
