Difference between revisions of "RXN-10061"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * common name:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10061 RXN-10061] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxycerotyl-[acp] dehy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10061 RXN-10061] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxycerotyl-[acp] dehydrase |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59] | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[R-3-hydroxycerotoyl-ACPs]][c] '''=>''' 1 [[Trans-D2-hexacos-2-enoyl-ACPs]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a (3R)-3-hydroxycerotoyl-[acp][c] '''=>''' 1 a trans-hexacos-2-enoyl-[acp][c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6884]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113] | ||
+ | ** '''8''' reactions found over '''12''' reactions in the full pathway | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-hydroxycerotyl-[acp] dehydrase}} | |
− | + | {{#set: ec number=EC-4.2.1.59}} | |
− | + | {{#set: gene associated=Tiso_gene_6884}} | |
− | + | {{#set: in pathway=PWY-6113|PWYG-321}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:22, 21 March 2018
Contents
Reaction RXN-10061
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-hydroxycerotyl-[acp] dehydrase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 R-3-hydroxycerotoyl-ACPs[c] => 1 Trans-D2-hexacos-2-enoyl-ACPs[c] + 1 WATER[c]
- With common name(s):
- 1 a (3R)-3-hydroxycerotoyl-[acp][c] => 1 a trans-hexacos-2-enoyl-[acp][c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6884
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
- PWY-6113, superpathway of mycolate biosynthesis: PWY-6113
- 8 reactions found over 12 reactions in the full pathway
- PWYG-321, mycolate biosynthesis: PWYG-321
- 86 reactions found over 182 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
"3-hydroxycerotyl-[acp] dehydrase" cannot be used as a page name in this wiki.