Difference between revisions of "PWY-6554"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * common name: ** N'-hyd...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
| − | ** | + | ** 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** phytate biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[ | + | * [[2.7.1.133-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_15232]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[2.7.1.139-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_15232]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[2.7.1.140-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-7163]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_15282]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7184 RXN-7184] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3)}} | |
| − | + | {{#set: common name=phytate biosynthesis}} | |
| − | {{#set: | + | {{#set: reaction found=4}} |
| − | {{#set: common name= | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=80.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:23, 21 March 2018
Pathway PWY-6554
- taxonomic range:
- common name:
- 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3)
- Synonym(s):
- phytate biosynthesis
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- 2.7.1.133-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- 2.7.1.139-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- 2.7.1.140-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-7163
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
