Difference between revisions of "RXN-15348"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15348 RXN-15348] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15348 RXN-15348] ==
* smiles:
+
* direction:
** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
+
** LEFT-TO-RIGHT
* common name:
+
** 5-hydroxyindole acetate
+
* inchi key:
+
** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
+
* molecular weight:
+
** 190.178   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxyindoleacetic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-10780]]
+
** 1 [[HS]][c] '''+''' 1 [[OXIDIZED-GLUTATHIONE]][c] '''=>''' 1 [[GLUTATHIONE]][c] '''+''' 1 [[CPD-11281]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 hydrogen sulfide[c] '''+''' 1 glutathione disulfide[c] '''=>''' 1 glutathione[c] '''+''' 1 S-sulfanylglutathione[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5285]], sulfide oxidation III (persulfide dioxygenase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5285 PWY-5285]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 54-16-0
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: in pathway=PWY-5285}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821]
+
{{#set: reconstruction category=annotation}}
* HMDB : HMDB00763
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622]
+
{{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}}
+
{{#set: common name=5-hydroxyindole acetate}}
+
{{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}}
+
{{#set: molecular weight=190.178    }}
+
{{#set: common name=5-hydroxyindoleacetic acid}}
+
{{#set: produced by=RXN-10780}}
+

Latest revision as of 19:23, 21 March 2018

Reaction RXN-15348

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 hydrogen sulfide[c] + 1 glutathione disulfide[c] => 1 glutathione[c] + 1 S-sulfanylglutathione[c]

Genes associated with this reaction

Pathways

  • PWY-5285, sulfide oxidation III (persulfide dioxygenase): PWY-5285
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links