Difference between revisions of "R01226"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * common name: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01226 R01226] == * direction: ** LEFT-TO-RIGHT * common name: ** R392 * Synonym(s): == Reaction F...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01226 R01226] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** R392 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1.0 [[2-KETO-ISOVALERATE]][c] '''+''' 1.0 [[METHYLENE-THF]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[2-DEHYDROPANTOATE]][c] '''+''' 1.0 [[THF]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1.0 3-methyl-2-oxobutanoate[c] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 2-dehydropantoate[c] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14465]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=R392}} | |
− | + | {{#set: gene associated=Tiso_gene_14465}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-synechocystis}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:23, 21 March 2018
Contents
Reaction R01226
- direction:
- LEFT-TO-RIGHT
- common name:
- R392
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 2-KETO-ISOVALERATE[c] + 1.0 METHYLENE-THF[c] + 1.0 WATER[c] => 1.0 2-DEHYDROPANTOATE[c] + 1.0 THF[c]
- With common name(s):
- 1.0 3-methyl-2-oxobutanoate[c] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] + 1.0 H2O[c] => 1.0 2-dehydropantoate[c] + 1.0 tetrahydropteroyl mono-L-glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14465
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis