Difference between revisions of "3-CYANOPYRIDINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == * smiles: ** C(C1(=CN=CC=C1))#N * common name: ** 3-cyanopy...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C1(=CN=CC=C1))#N |
* common name: | * common name: | ||
− | ** 3- | + | ** 3-cyanopyridine |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 104.111 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[R313-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 100-54-9 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79 79] |
− | {{#set: smiles=C( | + | * CHEMSPIDER: |
− | {{#set: common name=3- | + | ** [http://www.chemspider.com/Chemical-Structure.78.html 78] |
− | {{#set: inchi key=InChIKey= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86556 86556] |
− | {{#set: | + | * NCI: |
− | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=17558 17558] | |
+ | {{#set: smiles=C(C1(=CN=CC=C1))#N}} | ||
+ | {{#set: common name=3-cyanopyridine}} | ||
+ | {{#set: inchi key=InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=104.111 }} | ||
+ | {{#set: consumed by=R313-RXN}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite 3-CYANOPYRIDINE
- smiles:
- C(C1(=CN=CC=C1))#N
- common name:
- 3-cyanopyridine
- inchi key:
- InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N
- molecular weight:
- 104.111
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links