Difference between revisions of "PWY4FS-13"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7419 CPD-7419] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-13 PWY4FS-13] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7419 CPD-7419] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-13 PWY4FS-13] ==
* smiles:
+
* taxonomic range:
** CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** β-zeacarotene
+
** extended VTC2 cycle
* inchi key:
+
** InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N
+
* molecular weight:
+
** 538.898   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-1882]]
* [[RXN-8038]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_6621]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-13 RXN4FS-13]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-14 RXN4FS-14]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR01070259
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=extended VTC2 cycle}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280790 5280790]
+
{{#set: reaction found=1}}
* CHEMSPIDER:
+
{{#set: total reaction=3}}
** [http://www.chemspider.com/Chemical-Structure.4444348.html 4444348]
+
{{#set: completion rate=33.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27533 27533]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05434 C05434]
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1)}}
+
{{#set: common name=β-zeacarotene}}
+
{{#set: inchi key=InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N}}
+
{{#set: molecular weight=538.898    }}
+
{{#set: reversible reaction associated=RXN-8038}}
+

Latest revision as of 19:25, 21 March 2018

Pathway PWY4FS-13

  • taxonomic range:
  • common name:
    • extended VTC2 cycle
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links