Difference between revisions of "STRICTOSIDINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** formate assimilation into 5,10-methylenetetrahydrofolate
+
** strictosidine
 +
* inchi key:
 +
** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
 +
* molecular weight:
 +
** 531.581   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-α(S)-strictosidine
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[FORMATETHFLIG-RXN]]
+
* [[STRICTOSIDINE-SYNTHASE-RXN]]
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_432]]
+
*** [[Tiso_gene_7582]]
+
** 4 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[manual-primary_network]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-esiliculosus]]
+
* [[METHENYLTHFCYCLOHYDRO-RXN]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[manual-primary_network]]
+
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
+
** 2 associated gene(s):
+
*** [[Tiso_gene_6004]]
+
*** [[Tiso_gene_432]]
+
** 3 reconstruction source(s) associated:
+
*** [[manual-primary_network]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-esiliculosus]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* CAS : 20824-29-7
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291]
{{#set: common name=formate assimilation into 5,10-methylenetetrahydrofolate}}
+
* CHEBI:
{{#set: reaction found=3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559]
{{#set: total reaction=3}}
+
* LIGAND-CPD:
{{#set: completion rate=100.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470]
 +
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}}
 +
{{#set: common name=strictosidine}}
 +
{{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}}
 +
{{#set: molecular weight=531.581    }}
 +
{{#set: common name=3-α(S)-strictosidine}}
 +
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}}

Latest revision as of 19:25, 21 March 2018

Metabolite STRICTOSIDINE

  • smiles:
    • C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
  • common name:
    • strictosidine
  • inchi key:
    • InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
  • molecular weight:
    • 531.581
  • Synonym(s):
    • 3-α(S)-strictosidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))" cannot be used as a page name in this wiki.