Difference between revisions of "STRICTOSIDINE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** strictosidine |
+ | * inchi key: | ||
+ | ** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O | ||
+ | * molecular weight: | ||
+ | ** 531.581 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-α(S)-strictosidine | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | + | * CAS : 20824-29-7 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470] |
+ | {{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}} | ||
+ | {{#set: common name=strictosidine}} | ||
+ | {{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}} | ||
+ | {{#set: molecular weight=531.581 }} | ||
+ | {{#set: common name=3-α(S)-strictosidine}} | ||
+ | {{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}} |
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite STRICTOSIDINE
- smiles:
- C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
- common name:
- strictosidine
- inchi key:
- InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
- molecular weight:
- 531.581
- Synonym(s):
- 3-α(S)-strictosidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))" cannot be used as a page name in this wiki.