Difference between revisions of "Tiso gene 14344"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == * smiles: ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O * common na...")
(Created page with "Category:Gene == Gene Tiso_gene_14344 == * right end position: ** 5704 * transcription direction: ** POSITIVE * left end position: ** 4144 * centisome position: ** 72.5871...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] ==
+
== Gene Tiso_gene_14344 ==
−
* smiles:
+
* right end position:
−
** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O
+
** 5704
−
* common name:
+
* transcription direction:
−
** 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L
+
** 4144
−
* molecular weight:
+
* centisome position:
−
** 332.2    
+
** 72.58714    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.26.5-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[2.4.1.213-RXN]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6480]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1479]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5704}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658883 90658883]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=4144}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87089 87089]
+
{{#set: centisome position=72.58714   }}
−
{{#set: smiles=C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O}}
+
{{#set: reaction associated=3.1.26.5-RXN|RXN0-6480}}
−
{{#set: common name=2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate}}
+
{{#set: pathway associated=PWY0-1479}}
−
{{#set: inchi key=InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L}}
+
−
{{#set: molecular weight=332.2   }}
+
−
{{#set: reversible reaction associated=2.4.1.213-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Gene Tiso_gene_14344

  • right end position:
    • 5704
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4144
  • centisome position:
    • 72.58714
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14344&oldid=41524"