Difference between revisions of "Tiso gene 4395"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * co...") |
(Created page with "Category:Gene == Gene Tiso_gene_4395 == * right end position: ** 3849 * transcription direction: ** POSITIVE * left end position: ** 2834 * centisome position: ** 19.04186...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4395 == |
− | * | + | * right end position: |
− | ** | + | ** 3849 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2834 |
− | * | + | * centisome position: |
− | ** | + | ** 19.04186 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3849}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=2834}} |
− | {{#set: | + | {{#set: centisome position=19.04186 }} |
− | {{#set: | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:25, 21 March 2018
Gene Tiso_gene_4395
- right end position:
- 3849
- transcription direction:
- POSITIVE
- left end position:
- 2834
- centisome position:
- 19.04186
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation