Difference between revisions of "Tiso gene 4395"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * co...")
(Created page with "Category:Gene == Gene Tiso_gene_4395 == * right end position: ** 3849 * transcription direction: ** POSITIVE * left end position: ** 2834 * centisome position: ** 19.04186...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
+
== Gene Tiso_gene_4395 ==
* smiles:
+
* right end position:
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
+
** 3849
* common name:
+
* transcription direction:
** 6,7-dehydrobaicalein
+
** POSITIVE
* inchi key:
+
* left end position:
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
+
** 2834
* molecular weight:
+
* centisome position:
** 268.225    
+
** 19.04186    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
* [[RXN-14240]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=3849}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
+
{{#set: left end position=2834}}
{{#set: common name=6,7-dehydrobaicalein}}
+
{{#set: centisome position=19.04186   }}
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: molecular weight=268.225   }}
+
{{#set: produced by=RXN-14240}}
+

Latest revision as of 19:25, 21 March 2018

Gene Tiso_gene_4395

  • right end position:
    • 3849
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2834
  • centisome position:
    • 19.04186
  • Synonym(s):

Reactions associated

Pathways associated

External links