Difference between revisions of "PWY-6857"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * common...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857] ==
−
* smiles:
+
* taxonomic range:
−
** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 
* common name:
 
* common name:
−
** β-D-cellobiose
+
** retinol biosynthesis
−
* inchi key:
+
−
** InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
+
−
* molecular weight:
+
−
** 342.299   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-O-β-D-glucopyranosyl-β-D-glucopyranose
+
** vitamin A biosynthesis
−
** β-D-glucosyl-(1→4)-β-D-glucose
+
** retinal biosynthesis
 +
** retinoid biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10773]]
+
'''3''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-12575]]
−
* [[RXN-12305]]
+
** 13 associated gene(s):
−
* [[3.2.1.91-RXN]]
+
*** [[Tiso_gene_11351]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_1537]]
 +
*** [[Tiso_gene_4606]]
 +
*** [[Tiso_gene_17029]]
 +
*** [[Tiso_gene_1538]]
 +
*** [[Tiso_gene_9429]]
 +
*** [[Tiso_gene_19778]]
 +
*** [[Tiso_gene_4650]]
 +
*** [[Tiso_gene_12686]]
 +
*** [[Tiso_gene_10066]]
 +
*** [[Tiso_gene_16518]]
 +
*** [[Tiso_gene_1922]]
 +
*** [[Tiso_gene_2556]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-12579]]
 +
** 23 associated gene(s):
 +
*** [[Tiso_gene_2108]]
 +
*** [[Tiso_gene_17612]]
 +
*** [[Tiso_gene_3215]]
 +
*** [[Tiso_gene_17639]]
 +
*** [[Tiso_gene_11437]]
 +
*** [[Tiso_gene_8902]]
 +
*** [[Tiso_gene_17613]]
 +
*** [[Tiso_gene_9140]]
 +
*** [[Tiso_gene_288]]
 +
*** [[Tiso_gene_17614]]
 +
*** [[Tiso_gene_2109]]
 +
*** [[Tiso_gene_14063]]
 +
*** [[Tiso_gene_16817]]
 +
*** [[Tiso_gene_14062]]
 +
*** [[Tiso_gene_17143]]
 +
*** [[Tiso_gene_7915]]
 +
*** [[Tiso_gene_14109]]
 +
*** [[Tiso_gene_5716]]
 +
*** [[Tiso_gene_2983]]
 +
*** [[Tiso_gene_905]]
 +
*** [[Tiso_gene_19184]]
 +
*** [[Tiso_gene_14064]]
 +
*** [[Tiso_gene_906]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-13374]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_13078]]
 +
*** [[Tiso_gene_4653]]
 +
*** [[Tiso_gene_7740]]
 +
*** [[Tiso_gene_13079]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.135-RXN 2.3.1.135-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12548 RXN-12548]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12549 RXN-12549]
 
== External links  ==
 
== External links  ==
−
* CAS : 528-50-7
+
{{#set: taxonomic range=TAX-33208}}
−
* PUBCHEM:
+
{{#set: common name=retinol biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10712 10712]
+
{{#set: common name=vitamin A biosynthesis|retinal biosynthesis|retinoid biosynthesis}}
−
* HMDB : HMDB00055
+
{{#set: reaction found=3}}
−
* LIGAND-CPD:
+
{{#set: total reaction=7}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06422 C06422]
+
{{#set: completion rate=43.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10261.html 10261]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36217 36217]
+
−
{{#set: smiles=C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O}}
+
−
{{#set: common name=β-D-cellobiose}}
+
−
{{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=4-O-β-D-glucopyranosyl-β-D-glucopyranose|β-D-glucosyl-(1→4)-β-D-glucose}}
+
−
{{#set: consumed by=RXN-10773}}
+
−
{{#set: produced by=RXN-12305|3.2.1.91-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Pathway PWY-6857

  • taxonomic range:
  • common name:
    • retinol biosynthesis
  • Synonym(s):
    • vitamin A biosynthesis
    • retinal biosynthesis
    • retinoid biosynthesis

Reaction(s) found

3 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6857&oldid=41537"