Difference between revisions of "CPD-11525"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13302 RXN-13302] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13302 RXN-13302] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
+
** OPC4-CoA
 +
* inchi key:
 +
** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
 +
* molecular weight:
 +
** 983.813   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10707]]
** 1 [[CPD-14275]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-14280]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-10700]]
** 1 (3R)-3-hydroxy-arachidoyl-CoA[c] '''=>''' 1 H2O[c] '''+''' 1 trans-arachido-2-enoyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
** '''16''' reactions found over '''16''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-4.2.1.134}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211]
{{#set: in pathway=PWY-7036}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=OPC4-CoA}}
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
{{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=983.813    }}
 +
{{#set: consumed by=RXN-10707}}
 +
{{#set: produced by=RXN-10700}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-11525

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
  • common name:
    • OPC4-CoA
  • inchi key:
    • InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
  • molecular weight:
    • 983.813
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.