Difference between revisions of "CPD-17045"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * common name...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) |
* common name: | * common name: | ||
− | ** | + | ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 266.253 |
* Synonym(s): | * Synonym(s): | ||
− | ** 3- | + | ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP |
− | + | ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione | |
− | ** 3- | + | |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15680]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074] |
− | {{#set: smiles= | + | {{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}} |
− | {{#set: common name= | + | {{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=266.253 }} |
− | {{#set: common name=3- | + | {{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-15680}} |
− | + |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-17045
- smiles:
- C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
- common name:
- 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
- inchi key:
- InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
- molecular weight:
- 266.253
- Synonym(s):
- 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
- 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: