Difference between revisions of "N-terminal-L-cysteine-sulfinate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine-sulfinate N-terminal-L-cysteine-sulfinate] == * common name: ** an N-term...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine-sulfinate N-terminal-L-cysteine-sulfinate] ==
* smiles:
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
 
* common name:
 
* common name:
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** an N-terminal 3-sulfino-L-alanyl-[protein]
* inchi key:
+
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
+
* molecular weight:
+
** 447.424   
+
 
* Synonym(s):
 
* Synonym(s):
** di-trans,poly-cis-geranylgeranyl diphosphate
 
** ω,E,E,Z-geranylgeranyl diphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17883]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17882]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-13323]]
 
* [[RXN0-5180]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N-terminal 3-sulfino-L-alanyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
+
{{#set: consumed by=RXN-17883}}
* CHEBI:
+
{{#set: produced by=RXN-17882}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
+
{{#set: molecular weight=447.424    }}
+
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
+
{{#set: reversible reaction associated=RXN-13323|RXN0-5180}}
+

Latest revision as of 19:27, 21 March 2018

Metabolite N-terminal-L-cysteine-sulfinate

  • common name:
    • an N-terminal 3-sulfino-L-alanyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal 3-sulfino-L-alanyl-[protein" cannot be used as a page name in this wiki.